C23H16Cl2N4O5 — CID 135833361
2-(3,4-dichloroanilino)-8-[(E)-2-(4-hydroxy-2-methoxyphenyl)ethenyl]-6-nitro-3H-quinazolin-4-one (PubChem CID 135833361) has the molecular formula C23H16Cl2N4O5 and a molecular weight of 499.31 g/mol. Its IUPAC name is 2-(3,4-dichloroanilino)-8-[(E)-2-(4-hydroxy-2-methoxyphenyl)ethenyl]-6-nitro-3H-quinazolin-4-one.
| Compound Name | 2-(3,4-dichloroanilino)-8-[(E)-2-(4-hydroxy-2-methoxyphenyl)ethenyl]-6-nitro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135833361 |
| Molecular Formula | C23H16Cl2N4O5 |
| Molecular Weight | 499.31 g/mol |
| Exact Mass | 498.05 |
| IUPAC Name | 2-(3,4-dichloroanilino)-8-[(E)-2-(4-hydroxy-2-methoxyphenyl)ethenyl]-6-nitro-3H-quinazolin-4-one |
| SMILES | COc1cc(O)ccc1/C=C/c1cc([N+](=O)[O-])cc2c(=O)[nH]c(Nc3ccc(Cl)c(Cl)c3)nc12 |
| InChI | InChI=1S/C23H16Cl2N4O5/c1-34-20-11-16(30)6-4-12(20)2-3-13-8-15(29(32)33)10-17-21(13)27-23(28-22(17)31)26-14-5-7-18(24)19(25)9-14/h2-11,30H,1H3,(H2,26,27,28,31)/b3-2+ |
| InChIKey | KNSYVOUVHKBQFB-NSCUHMNNSA-N |
| XLogP | 5.77 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.31 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|