C18H15N5O — CID 135856364
(3Z)-5-methyl-3-[(3-phenyl-3,4-dihydropyrazol-5-ylidene)hydrazinylidene]-1H-indol-2-one (PubChem CID 135856364) has the molecular formula C18H15N5O and a molecular weight of 317.35 g/mol. Its IUPAC name is (3Z)-5-methyl-3-[(3-phenyl-3,4-dihydropyrazol-5-ylidene)hydrazinylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-methyl-3-[(3-phenyl-3,4-dihydropyrazol-5-ylidene)hydrazinylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 135856364 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | (3Z)-5-methyl-3-[(3-phenyl-3,4-dihydropyrazol-5-ylidene)hydrazinylidene]-1H-indol-2-one |
| SMILES | Cc1ccc2c(c1)/C(=N/N=C1CC(c3ccccc3)N=N1)C(=O)N2 |
| InChI | InChI=1S/C18H15N5O/c1-11-7-8-14-13(9-11)17(18(24)19-14)23-22-16-10-15(20-21-16)12-5-3-2-4-6-12/h2-9,15H,10H2,1H3,(H,19,23,24) |
| InChIKey | WJDUQBNYYFFLRM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 78.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|