C22H15Cl2N5O2 — CID 135870046
N,5-bis(4-chlorophenyl)-3-oxo-4-phenyldiazenyl-1H-pyrazole-2-carboxamide (PubChem CID 135870046) has the molecular formula C22H15Cl2N5O2 and a molecular weight of 452.30 g/mol. Its IUPAC name is N,5-bis(4-chlorophenyl)-3-oxo-4-phenyldiazenyl-1H-pyrazole-2-carboxamide.
| Compound Name | N,5-bis(4-chlorophenyl)-3-oxo-4-phenyldiazenyl-1H-pyrazole-2-carboxamide |
|---|---|
| PubChem CID | 135870046 |
| Molecular Formula | C22H15Cl2N5O2 |
| Molecular Weight | 452.30 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | N,5-bis(4-chlorophenyl)-3-oxo-4-phenyldiazenyl-1H-pyrazole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)n1[nH]c(-c2ccc(Cl)cc2)c(/N=N/c2ccccc2)c1=O |
| InChI | InChI=1S/C22H15Cl2N5O2/c23-15-8-6-14(7-9-15)19-20(27-26-18-4-2-1-3-5-18)21(30)29(28-19)22(31)25-17-12-10-16(24)11-13-17/h1-13,28H,(H,25,31)/b27-26+ |
| InChIKey | KEKXERVQUVEMAE-CYYJNZCTSA-N |
| XLogP | 6.65 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.30 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|