C17H18N6O4 — CID 135870809
5-[[2-ethoxy-6-(furan-2-ylmethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-yl]amino]-3H-1,3-benzoxazol-2-one (PubChem CID 135870809) has the molecular formula C17H18N6O4 and a molecular weight of 370.37 g/mol. Its IUPAC name is 5-[[2-ethoxy-6-(furan-2-ylmethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-yl]amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[[2-ethoxy-6-(furan-2-ylmethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-yl]amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 135870809 |
| Molecular Formula | C17H18N6O4 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 5-[[2-ethoxy-6-(furan-2-ylmethylimino)-2,5-dihydro-1H-1,3,5-triazin-4-yl]amino]-3H-1,3-benzoxazol-2-one |
| SMILES | CCOC1N=C(Nc2ccc3oc(=O)[nH]c3c2)N/C(=N/Cc2ccco2)N1 |
| InChI | InChI=1S/C17H18N6O4/c1-2-25-16-22-14(18-9-11-4-3-7-26-11)21-15(23-16)19-10-5-6-13-12(8-10)20-17(24)27-13/h3-8,16H,2,9H2,1H3,(H,20,24)(H3,18,19,21,22,23) |
| InChIKey | UEGXVHDQZNRBBQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|