About (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine
(NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine (PubChem CID 135894339) has the molecular formula C9H6F3N5O
and a molecular weight of 257.18 g/mol. Its IUPAC name is (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine |
| PubChem CID | 135894339 |
| Molecular Formula | C9H6F3N5O |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine |
| SMILES | O/N=C(\c1cc(C(F)(F)F)ccn1)n1cncn1 |
| InChI | InChI=1S/C9H6F3N5O/c10-9(11,12)6-1-2-14-7(3-6)8(16-18)17-5-13-4-15-17/h1-5,18H/b16-8+ |
| InChIKey | IICGNILLFOFHHR-LZYBPNLTSA-N |
| XLogP | 1.38 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine?
The IUPAC name of (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine (CID 135894339) is (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine is O/N=C(\c1cc(C(F)(F)F)ccn1)n1cncn1.
What is the InChIKey of (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine?
The InChIKey is IICGNILLFOFHHR-LZYBPNLTSA-N. The full InChI is InChI=1S/C9H6F3N5O/c10-9(11,12)6-1-2-14-7(3-6)8(16-18)17-5-13-4-15-17/h1-5,18H/b16-8+.
What are the key properties of (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine?
(NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine has a molecular weight of 257.18 g/mol, XLogP of 1.38, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[1,2,4-triazol-1-yl-[4-(trifluoromethyl)-2-pyridinyl]methylidene]hydroxylamine is sourced from PubChem (CID 135894339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).