C12H12F3N5O — CID 46207255
(E)-N-ethoxy-1-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]-1-(1,2,4-triazol-1-yl)methanimine (PubChem CID 46207255) has the molecular formula C12H12F3N5O and a molecular weight of 299.26 g/mol. Its IUPAC name is (E)-N-ethoxy-1-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]-1-(1,2,4-triazol-1-yl)methanimine.
| Compound Name | (E)-N-ethoxy-1-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]-1-(1,2,4-triazol-1-yl)methanimine |
|---|---|
| PubChem CID | 46207255 |
| Molecular Formula | C12H12F3N5O |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (E)-N-ethoxy-1-[3-methyl-5-(trifluoromethyl)-2-pyridinyl]-1-(1,2,4-triazol-1-yl)methanimine |
| SMILES | CCO/N=C(\c1ncc(C(F)(F)F)cc1C)n1cncn1 |
| InChI | InChI=1S/C12H12F3N5O/c1-3-21-19-11(20-7-16-6-18-20)10-8(2)4-9(5-17-10)12(13,14)15/h4-7H,3H2,1-2H3/b19-11+ |
| InChIKey | ZUEJALICMBJEOI-YBFXNURJSA-N |
| XLogP | 2.25 |
| TPSA | 65.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|