C9H9F3N2O3 — CID 137251918
2,2,2-trifluoro-1-[2-(N-hydroxy-C-methylcarbonimidoyl)-4-pyridinyl]ethane-1,1-diol (PubChem CID 137251918) has the molecular formula C9H9F3N2O3 and a molecular weight of 250.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-(N-hydroxy-C-methylcarbonimidoyl)-4-pyridinyl]ethane-1,1-diol.
| Compound Name | 2,2,2-trifluoro-1-[2-(N-hydroxy-C-methylcarbonimidoyl)-4-pyridinyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 137251918 |
| Molecular Formula | C9H9F3N2O3 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-(N-hydroxy-C-methylcarbonimidoyl)-4-pyridinyl]ethane-1,1-diol |
| SMILES | CC(=NO)c1cc(C(O)(O)C(F)(F)F)ccn1 |
| InChI | InChI=1S/C9H9F3N2O3/c1-5(14-17)7-4-6(2-3-13-7)8(15,16)9(10,11)12/h2-4,15-17H,1H3 |
| InChIKey | ZNJAVSNBPILGCH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|