C39H45N5O3 — CID 135906465
tert-butyl N-[5-[[4-[2-(benzylamino)-2-oxoethyl]-3-(4-phenylphenyl)-1,4-dihydroquinazolin-2-ylidene]amino]pentyl]carbamate (PubChem CID 135906465) has the molecular formula C39H45N5O3 and a molecular weight of 631.82 g/mol. Its IUPAC name is tert-butyl N-[5-[[4-[2-(benzylamino)-2-oxoethyl]-3-(4-phenylphenyl)-1,4-dihydroquinazolin-2-ylidene]amino]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[[4-[2-(benzylamino)-2-oxoethyl]-3-(4-phenylphenyl)-1,4-dihydroquinazolin-2-ylidene]amino]pentyl]carbamate |
|---|---|
| PubChem CID | 135906465 |
| Molecular Formula | C39H45N5O3 |
| Molecular Weight | 631.82 g/mol |
| Exact Mass | 631.35 |
| IUPAC Name | tert-butyl N-[5-[[4-[2-(benzylamino)-2-oxoethyl]-3-(4-phenylphenyl)-1,4-dihydroquinazolin-2-ylidene]amino]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC/N=C1\Nc2ccccc2C(CC(=O)NCc2ccccc2)N1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C39H45N5O3/c1-39(2,3)47-38(46)41-26-14-6-13-25-40-37-43-34-20-12-11-19-33(34)35(27-36(45)42-28-29-15-7-4-8-16-29)44(37)32-23-21-31(22-24-32)30-17-9-5-10-18-30/h4-5,7-12,15-24,35H,6,13-14,25-28H2,1-3H3,(H,40,43)(H,41,46)(H,42,45) |
| InChIKey | BMCLTRZPRHKBKB-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.82 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|