C17H15N7O5 — CID 135909251
4-hydroxy-N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-iminoquinoxaline-2-carboximidamide (PubChem CID 135909251) has the molecular formula C17H15N7O5 and a molecular weight of 397.35 g/mol. Its IUPAC name is 4-hydroxy-N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-iminoquinoxaline-2-carboximidamide.
| Compound Name | 4-hydroxy-N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-iminoquinoxaline-2-carboximidamide |
|---|---|
| PubChem CID | 135909251 |
| Molecular Formula | C17H15N7O5 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 4-hydroxy-N'-[(Z)-(4-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-3-iminoquinoxaline-2-carboximidamide |
| SMILES | [H]/N=c1/c(/C(N)=N/N=C\c2cc(OC)c(O)c([N+](=O)[O-])c2)nc2ccccc2n1O |
| InChI | InChI=1S/C17H15N7O5/c1-29-13-7-9(6-12(15(13)25)24(27)28)8-20-22-16(18)14-17(19)23(26)11-5-3-2-4-10(11)21-14/h2-8,19,25-26H,1H3,(H2,18,22)/b19-17-,20-8- |
| InChIKey | GAOZVUKQJGWBPK-JJRMVNKTSA-N |
| XLogP | 1.11 |
| TPSA | 185.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|