C21H19ClN4O5S — CID 135920862
[2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135920862) has the molecular formula C21H19ClN4O5S and a molecular weight of 474.93 g/mol. Its IUPAC name is [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135920862 |
| Molecular Formula | C21H19ClN4O5S |
| Molecular Weight | 474.93 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | [2-[3-chloro-N-(2-cyanoethyl)anilino]-2-oxoethyl] 3-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | N#CCCN(C(=O)COC(=O)CC/N=C1\NS(=O)(=O)c2ccccc21)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H19ClN4O5S/c22-15-5-3-6-16(13-15)26(12-4-10-23)19(27)14-31-20(28)9-11-24-21-17-7-1-2-8-18(17)32(29,30)25-21/h1-3,5-8,13H,4,9,11-12,14H2,(H,24,25) |
| InChIKey | LSVFXFNHUWIAQP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 128.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.93 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|