C17H20N6O6 — CID 135922395
ethyl N-[4-(ethoxycarbonylamino)-3-methyl-5-[(4-nitrophenyl)diazenyl]-1H-pyrrol-2-yl]carbamate (PubChem CID 135922395) has the molecular formula C17H20N6O6 and a molecular weight of 404.38 g/mol. Its IUPAC name is ethyl N-[4-(ethoxycarbonylamino)-3-methyl-5-[(4-nitrophenyl)diazenyl]-1H-pyrrol-2-yl]carbamate.
| Compound Name | ethyl N-[4-(ethoxycarbonylamino)-3-methyl-5-[(4-nitrophenyl)diazenyl]-1H-pyrrol-2-yl]carbamate |
|---|---|
| PubChem CID | 135922395 |
| Molecular Formula | C17H20N6O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | ethyl N-[4-(ethoxycarbonylamino)-3-methyl-5-[(4-nitrophenyl)diazenyl]-1H-pyrrol-2-yl]carbamate |
| SMILES | CCOC(=O)Nc1[nH]c(/N=N/c2ccc([N+](=O)[O-])cc2)c(NC(=O)OCC)c1C |
| InChI | InChI=1S/C17H20N6O6/c1-4-28-16(24)18-13-10(3)14(20-17(25)29-5-2)19-15(13)22-21-11-6-8-12(9-7-11)23(26)27/h6-9,19H,4-5H2,1-3H3,(H,18,24)(H,20,25)/b22-21+ |
| InChIKey | WVLQYUIPUWVNRR-QURGRASLSA-N |
| XLogP | 4.78 |
| TPSA | 160.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|