C15H21N3O6 — CID 135922677
N'-hydroxy-N-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]octanediamide (PubChem CID 135922677) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is N'-hydroxy-N-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]octanediamide.
| Compound Name | N'-hydroxy-N-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]octanediamide |
|---|---|
| PubChem CID | 135922677 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N'-hydroxy-N-[(E)-(2,4,6-trihydroxyphenyl)methylideneamino]octanediamide |
| SMILES | O=C(CCCCCCC(=O)N/N=C/c1c(O)cc(O)cc1O)NO |
| InChI | InChI=1S/C15H21N3O6/c19-10-7-12(20)11(13(21)8-10)9-16-17-14(22)5-3-1-2-4-6-15(23)18-24/h7-9,19-21,24H,1-6H2,(H,17,22)(H,18,23)/b16-9+ |
| InChIKey | KJYNQOYUWKHQSC-CXUHLZMHSA-N |
| XLogP | 1.10 |
| TPSA | 151.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|