C16H16N2O4 — CID 137290226
3-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]propanamide (PubChem CID 137290226) has the molecular formula C16H16N2O4 and a molecular weight of 300.31 g/mol. Its IUPAC name is 3-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]propanamide.
| Compound Name | 3-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 137290226 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 3-phenyl-N-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]propanamide |
| SMILES | O=C(CCc1ccccc1)N/N=C/c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C16H16N2O4/c19-13-8-7-12(15(21)16(13)22)10-17-18-14(20)9-6-11-4-2-1-3-5-11/h1-5,7-8,10,19,21-22H,6,9H2,(H,18,20)/b17-10+ |
| InChIKey | PNQZRDGCUZTOKE-LICLKQGHSA-N |
| XLogP | 1.89 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|