C18H14ClF3N2O2 — CID 135924149
2-[2-chloro-5-(trifluoromethyl)phenyl]-1-[5-(4-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 135924149) has the molecular formula C18H14ClF3N2O2 and a molecular weight of 382.77 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)phenyl]-1-[5-(4-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]-1-[5-(4-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 135924149 |
| Molecular Formula | C18H14ClF3N2O2 |
| Molecular Weight | 382.77 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]-1-[5-(4-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | O=C(Cc1cc(C(F)(F)F)ccc1Cl)N1CCC(c2ccc(O)cc2)=N1 |
| InChI | InChI=1S/C18H14ClF3N2O2/c19-15-6-3-13(18(20,21)22)9-12(15)10-17(26)24-8-7-16(23-24)11-1-4-14(25)5-2-11/h1-6,9,25H,7-8,10H2 |
| InChIKey | YFTSURXOXMIVNQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.77 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|