C60H46N8+4 — CID 135936226
5-(1-methyl-5-pyren-1-ylpyridin-1-ium-3-yl)-10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin (PubChem CID 135936226) has the molecular formula C60H46N8+4 and a molecular weight of 879.08 g/mol. Its IUPAC name is 5-(1-methyl-5-pyren-1-ylpyridin-1-ium-3-yl)-10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin.
| Compound Name | 5-(1-methyl-5-pyren-1-ylpyridin-1-ium-3-yl)-10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135936226 |
| Molecular Formula | C60H46N8+4 |
| Molecular Weight | 879.08 g/mol |
| Exact Mass | 878.38 |
| IUPAC Name | 5-(1-methyl-5-pyren-1-ylpyridin-1-ium-3-yl)-10,15,20-tris(1-methylpyridin-1-ium-4-yl)-21,23-dihydroporphyrin |
| SMILES | C[n+]1ccc(-c2c3nc(c(-c4cc[n+](C)cc4)c4ccc([nH]4)c(-c4cc(-c5ccc6ccc7cccc8ccc5c6c78)c[n+](C)c4)c4nc(c(-c5cc[n+](C)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C60H45N8/c1-65-28-22-40(23-29-65)57-47-14-16-49(61-47)58(41-24-30-66(2)31-25-41)51-18-20-53(63-51)60(54-21-19-52(64-54)59(50-17-15-48(57)62-50)42-26-32-67(3)33-27-42)44-34-43(35-68(4)36-44)45-12-10-39-9-8-37-6-5-7-38-11-13-46(45)56(39)55(37)38/h5-36H,1-4H3,(H,61,62,63,64)/q+3/p+1/b57-47-,57-48-,58-49-,58-51-,59-50-,59-52-,60-53-,60-54- |
| InChIKey | KICFGWGXMAKFFW-HHJDUUKYSA-O |
| XLogP | 11.19 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.08 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|