C70H66N4 — CID 136785348
5,15-bis(3,5-ditert-butylphenyl)-10-phenyl-20-pyren-1-yl-21,23-dihydroporphyrin (PubChem CID 136785348) has the molecular formula C70H66N4 and a molecular weight of 963.33 g/mol. Its IUPAC name is 5,15-bis(3,5-ditert-butylphenyl)-10-phenyl-20-pyren-1-yl-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(3,5-ditert-butylphenyl)-10-phenyl-20-pyren-1-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136785348 |
| Molecular Formula | C70H66N4 |
| Molecular Weight | 963.33 g/mol |
| Exact Mass | 962.53 |
| IUPAC Name | 5,15-bis(3,5-ditert-butylphenyl)-10-phenyl-20-pyren-1-yl-21,23-dihydroporphyrin |
| SMILES | CC(C)(C)c1cc(-c2c3nc(c(-c4ccc5ccc6cccc7ccc4c5c67)c4ccc([nH]4)c(-c4cc(C(C)(C)C)cc(C(C)(C)C)c4)c4nc(c(-c5ccccc5)c5ccc2[nH]5)C=C4)C=C3)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C70H66N4/c1-67(2,3)47-35-45(36-48(39-47)68(4,5)6)64-55-29-27-53(71-55)63(41-17-14-13-15-18-41)54-28-30-56(72-54)65(46-37-49(69(7,8)9)40-50(38-46)70(10,11)12)58-32-34-60(74-58)66(59-33-31-57(64)73-59)52-26-24-44-22-21-42-19-16-20-43-23-25-51(52)62(44)61(42)43/h13-40,71,74H,1-12H3/b63-53-,63-54-,64-55-,64-57-,65-56-,65-58-,66-59-,66-60- |
| InChIKey | UOJFNRKNJUHKEM-IZMBGZKHSA-N |
| XLogP | 19.41 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.33 |
| LogP ≤ 5 | 19.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|