C78H82N4 — CID 136785352
5,15-bis(3,5-ditert-butylphenyl)-10-(3,8-dibutylpyren-1-yl)-20-phenyl-21,23-dihydroporphyrin (PubChem CID 136785352) has the molecular formula C78H82N4 and a molecular weight of 1075.54 g/mol. Its IUPAC name is 5,15-bis(3,5-ditert-butylphenyl)-10-(3,8-dibutylpyren-1-yl)-20-phenyl-21,23-dihydroporphyrin.
| Compound Name | 5,15-bis(3,5-ditert-butylphenyl)-10-(3,8-dibutylpyren-1-yl)-20-phenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 136785352 |
| Molecular Formula | C78H82N4 |
| Molecular Weight | 1075.54 g/mol |
| Exact Mass | 1074.65 |
| IUPAC Name | 5,15-bis(3,5-ditert-butylphenyl)-10-(3,8-dibutylpyren-1-yl)-20-phenyl-21,23-dihydroporphyrin |
| SMILES | CCCCc1ccc2ccc3c(CCCC)cc(-c4c5nc(c(-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)c6ccc([nH]6)c(-c6ccccc6)c6nc(c(-c7cc(C(C)(C)C)cc(C(C)(C)C)c7)c7ccc4[nH]7)C=C6)C=C5)c4ccc1c2c34 |
| InChI | InChI=1S/C78H82N4/c1-15-17-22-47-26-27-49-28-29-58-50(23-18-16-2)44-60(59-31-30-57(47)69(49)73(58)59)74-67-38-36-65(81-67)71(51-40-53(75(3,4)5)45-54(41-51)76(6,7)8)63-34-32-61(79-63)70(48-24-20-19-21-25-48)62-33-35-64(80-62)72(66-37-39-68(74)82-66)52-42-55(77(9,10)11)46-56(43-52)78(12,13)14/h19-21,24-46,79,82H,15-18,22-23H2,1-14H3/b70-61-,70-62-,71-63-,71-65-,72-64-,72-66-,74-67-,74-68- |
| InChIKey | WRYMNOFPEUFOHW-IPODRXSKSA-N |
| XLogP | 22.10 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1075.54 |
| LogP ≤ 5 | 22.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|