C64H54N7O3S+3 — CID 173100642
4-methylbenzenesulfonic acid;5,10,15-tris(1-ethylpyridin-1-ium-4-yl)-20-pyren-1-yl-21,23-dihydroporphyrin (PubChem CID 173100642) has the molecular formula C64H54N7O3S+3 and a molecular weight of 1001.25 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;5,10,15-tris(1-ethylpyridin-1-ium-4-yl)-20-pyren-1-yl-21,23-dihydroporphyrin.
| Compound Name | 4-methylbenzenesulfonic acid;5,10,15-tris(1-ethylpyridin-1-ium-4-yl)-20-pyren-1-yl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 173100642 |
| Molecular Formula | C64H54N7O3S+3 |
| Molecular Weight | 1001.25 g/mol |
| Exact Mass | 1000.40 |
| IUPAC Name | 4-methylbenzenesulfonic acid;5,10,15-tris(1-ethylpyridin-1-ium-4-yl)-20-pyren-1-yl-21,23-dihydroporphyrin |
| SMILES | CC[n+]1ccc(-c2c3nc(c(-c4cc[n+](CC)cc4)c4ccc([nH]4)c(-c4ccc5ccc6cccc7ccc4c5c67)c4nc(c(-c5cc[n+](CC)cc5)c5ccc2[nH]5)C=C4)C=C3)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C57H45N7.C7H8O3S/c1-4-62-30-24-39(25-31-62)54-44-16-18-46(58-44)55(40-26-32-63(5-2)33-27-40)48-20-22-50(60-48)57(43-15-13-38-11-10-36-8-7-9-37-12-14-42(43)53(38)52(36)37)51-23-21-49(61-51)56(47-19-17-45(54)59-47)41-28-34-64(6-3)35-29-41;1-6-2-4-7(5-3-6)11(8,9)10/h7-35H,4-6H2,1-3H3,(H,58,59,60,61);2-5H,1H3,(H,8,9,10)/q+2;/p+1/b54-44-,54-45-,55-46-,55-48-,56-47-,56-49-,57-50-,57-51-; |
| InChIKey | NBCILJUOLDVFNV-YQRRWSLASA-O |
| XLogP | 13.38 |
| TPSA | 123.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.25 |
| LogP ≤ 5 | 13.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|