C4H4ClN3O — CID 135947952
4-amino-2-chloro-1H-pyrimidin-6-one (PubChem CID 135947952) has the molecular formula C4H4ClN3O and a molecular weight of 145.55 g/mol. Its IUPAC name is 4-amino-2-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-amino-2-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135947952 |
| Molecular Formula | C4H4ClN3O |
| Molecular Weight | 145.55 g/mol |
| Exact Mass | 145.00 |
| IUPAC Name | 4-amino-2-chloro-1H-pyrimidin-6-one |
| SMILES | Nc1cc(=O)[nH]c(Cl)n1 |
| InChI | InChI=1S/C4H4ClN3O/c5-4-7-2(6)1-3(9)8-4/h1H,(H3,6,7,8,9) |
| InChIKey | CZOBFXHVXPTWPT-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.55 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |