C15H22AgNO3S — CID 135951806
silver;(Z)-3-hydroxy-1-(4-hydroxyphenyl)-3-oxoprop-1-ene-2-thiolate;N-propan-2-ylpropan-2-amine (PubChem CID 135951806) has the molecular formula C15H22AgNO3S and a molecular weight of 404.28 g/mol. Its IUPAC name is silver;(Z)-3-hydroxy-1-(4-hydroxyphenyl)-3-oxoprop-1-ene-2-thiolate;N-propan-2-ylpropan-2-amine.
| Compound Name | silver;(Z)-3-hydroxy-1-(4-hydroxyphenyl)-3-oxoprop-1-ene-2-thiolate;N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 135951806 |
| Molecular Formula | C15H22AgNO3S |
| Molecular Weight | 404.28 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | silver;(Z)-3-hydroxy-1-(4-hydroxyphenyl)-3-oxoprop-1-ene-2-thiolate;N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)C.O=C(O)/C([S-])=C/c1ccc(O)cc1.[Ag+] |
| InChI | InChI=1S/C9H8O3S.C6H15N.Ag/c10-7-3-1-6(2-4-7)5-8(13)9(11)12;1-5(2)7-6(3)4;/h1-5,10,13H,(H,11,12);5-7H,1-4H3;/q;;+1/p-1/b8-5-;; |
| InChIKey | YPPWWZSMZBRGCC-XTKZWJJBSA-M |
| XLogP | 2.75 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.28 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|