C26H26N4O2S — CID 135957044
5-(2-hydroxyphenyl)-3-(4-morpholin-4-ylphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide (PubChem CID 135957044) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 5-(2-hydroxyphenyl)-3-(4-morpholin-4-ylphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide.
| Compound Name | 5-(2-hydroxyphenyl)-3-(4-morpholin-4-ylphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide |
|---|---|
| PubChem CID | 135957044 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 5-(2-hydroxyphenyl)-3-(4-morpholin-4-ylphenyl)-N-phenyl-3,4-dihydropyrazole-2-carbothioamide |
| SMILES | Oc1ccccc1C1=NN(C(=S)Nc2ccccc2)C(c2ccc(N3CCOCC3)cc2)C1 |
| InChI | InChI=1S/C26H26N4O2S/c31-25-9-5-4-8-22(25)23-18-24(30(28-23)26(33)27-20-6-2-1-3-7-20)19-10-12-21(13-11-19)29-14-16-32-17-15-29/h1-13,24,31H,14-18H2,(H,27,33) |
| InChIKey | MIBCWCWMMIUCQK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|