C11H9N3OS2 — CID 135959417
(2E)-2-[(6-methyl-1,3-benzothiazol-2-yl)imino]-1,3-thiazolidin-4-one (PubChem CID 135959417) has the molecular formula C11H9N3OS2 and a molecular weight of 263.35 g/mol. Its IUPAC name is (2E)-2-[(6-methyl-1,3-benzothiazol-2-yl)imino]-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(6-methyl-1,3-benzothiazol-2-yl)imino]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135959417 |
| Molecular Formula | C11H9N3OS2 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.02 |
| IUPAC Name | (2E)-2-[(6-methyl-1,3-benzothiazol-2-yl)imino]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc2nc(/N=C3\NC(=O)CS3)sc2c1 |
| InChI | InChI=1S/C11H9N3OS2/c1-6-2-3-7-8(4-6)17-11(12-7)14-10-13-9(15)5-16-10/h2-4H,5H2,1H3,(H,12,13,14,15) |
| InChIKey | NYYUDTVBIZNUPT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|