C26H16N6O2 — CID 135961578
(3Z)-3-[[6-[6-[(Z)-(3-oxoisoindol-1-ylidene)amino]-2-pyridinyl]-2-pyridinyl]imino]isoindol-1-one (PubChem CID 135961578) has the molecular formula C26H16N6O2 and a molecular weight of 444.45 g/mol. Its IUPAC name is (3Z)-3-[[6-[6-[(Z)-(3-oxoisoindol-1-ylidene)amino]-2-pyridinyl]-2-pyridinyl]imino]isoindol-1-one.
| Compound Name | (3Z)-3-[[6-[6-[(Z)-(3-oxoisoindol-1-ylidene)amino]-2-pyridinyl]-2-pyridinyl]imino]isoindol-1-one |
|---|---|
| PubChem CID | 135961578 |
| Molecular Formula | C26H16N6O2 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | (3Z)-3-[[6-[6-[(Z)-(3-oxoisoindol-1-ylidene)amino]-2-pyridinyl]-2-pyridinyl]imino]isoindol-1-one |
| SMILES | O=C1N/C(=N\c2cccc(-c3cccc(/N=C4\NC(=O)c5ccccc54)n3)n2)c2ccccc21 |
| InChI | InChI=1S/C26H16N6O2/c33-25-17-9-3-1-7-15(17)23(31-25)29-21-13-5-11-19(27-21)20-12-6-14-22(28-20)30-24-16-8-2-4-10-18(16)26(34)32-24/h1-14H,(H,27,29,31,33)(H,28,30,32,34) |
| InChIKey | KBODYPDZWSHCIS-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|