C11H14N2O4 — CID 135964579
5-[(Z)-morpholin-4-yliminomethyl]benzene-1,2,3-triol (PubChem CID 135964579) has the molecular formula C11H14N2O4 and a molecular weight of 238.24 g/mol. Its IUPAC name is 5-[(Z)-morpholin-4-yliminomethyl]benzene-1,2,3-triol.
| Compound Name | 5-[(Z)-morpholin-4-yliminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135964579 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 5-[(Z)-morpholin-4-yliminomethyl]benzene-1,2,3-triol |
| SMILES | Oc1cc(/C=N\N2CCOCC2)cc(O)c1O |
| InChI | InChI=1S/C11H14N2O4/c14-9-5-8(6-10(15)11(9)16)7-12-13-1-3-17-4-2-13/h5-7,14-16H,1-4H2/b12-7- |
| InChIKey | DPIWUQFAJAKVAS-GHXNOFRVSA-N |
| XLogP | 0.47 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|