C12H17N3O3 — CID 135964575
4-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol (PubChem CID 135964575) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 4-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol.
| Compound Name | 4-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135964575 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-[(Z)-(4-methylpiperazin-1-yl)iminomethyl]benzene-1,2,3-triol |
| SMILES | CN1CCN(/N=C\c2ccc(O)c(O)c2O)CC1 |
| InChI | InChI=1S/C12H17N3O3/c1-14-4-6-15(7-5-14)13-8-9-2-3-10(16)12(18)11(9)17/h2-3,8,16-18H,4-7H2,1H3/b13-8- |
| InChIKey | CBSCXPMMSNYBRO-JYRVWZFOSA-N |
| XLogP | 0.38 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|