C13H20N3O3+ — CID 135964581
5-[(Z)-(4,4-dimethylpiperazin-4-ium-1-yl)iminomethyl]benzene-1,2,3-triol (PubChem CID 135964581) has the molecular formula C13H20N3O3+ and a molecular weight of 266.32 g/mol. Its IUPAC name is 5-[(Z)-(4,4-dimethylpiperazin-4-ium-1-yl)iminomethyl]benzene-1,2,3-triol.
| Compound Name | 5-[(Z)-(4,4-dimethylpiperazin-4-ium-1-yl)iminomethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 135964581 |
| Molecular Formula | C13H20N3O3+ |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 5-[(Z)-(4,4-dimethylpiperazin-4-ium-1-yl)iminomethyl]benzene-1,2,3-triol |
| SMILES | C[N+]1(C)CCN(/N=C\c2cc(O)c(O)c(O)c2)CC1 |
| InChI | InChI=1S/C13H19N3O3/c1-16(2)5-3-15(4-6-16)14-9-10-7-11(17)13(19)12(18)8-10/h7-9H,3-6H2,1-2H3,(H2-,14,17,18,19)/p+1 |
| InChIKey | BBXOBYDHXRUUEW-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|