About dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol
dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol (PubChem CID 135967148) has the molecular formula C25H19Br2NOV
and a molecular weight of 560.19 g/mol. Its IUPAC name is dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol.
Molecular Properties
| Compound Name | dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol |
| PubChem CID | 135967148 |
| Molecular Formula | C25H19Br2NOV |
| Molecular Weight | 560.19 g/mol |
| Exact Mass | 557.93 |
| IUPAC Name | dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol |
| SMILES | Br[V]Br.Oc1c(/C(=N/c2ccccc2)c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C25H19NO.2BrH.V/c27-25-22(19-11-4-1-5-12-19)17-10-18-23(25)24(20-13-6-2-7-14-20)26-21-15-8-3-9-16-21;;;/h1-18,27H;2*1H;/q;;;+2/p-2/b26-24+;;; |
| InChIKey | MDNAQPLOBNLDJX-XNLHTSAWSA-L |
| XLogP | 7.92 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 560.19 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol?
The IUPAC name of dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol (CID 135967148) is dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol.
What is the SMILES notation for dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol?
The canonical SMILES for dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol is Br[V]Br.Oc1c(/C(=N/c2ccccc2)c2ccccc2)cccc1-c1ccccc1.
What is the InChIKey of dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol?
The InChIKey is MDNAQPLOBNLDJX-XNLHTSAWSA-L. The full InChI is InChI=1S/C25H19NO.2BrH.V/c27-25-22(19-11-4-1-5-12-19)17-10-18-23(25)24(20-13-6-2-7-14-20)26-21-15-8-3-9-16-21;;;/h1-18,27H;2*1H;/q;;;+2/p-2/b26-24+;;;.
What are the key properties of dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol?
dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol has a molecular weight of 560.19 g/mol, XLogP of 7.92, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dibromovanadium;2-(C,N-diphenylcarbonimidoyl)-6-phenylphenol is sourced from PubChem (CID 135967148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).