C21H15NOS — CID 3582254
2-(C,N-diphenylcarbonimidoyl)-1-benzothiophen-3-ol (PubChem CID 3582254) has the molecular formula C21H15NOS and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-(C,N-diphenylcarbonimidoyl)-1-benzothiophen-3-ol.
| Compound Name | 2-(C,N-diphenylcarbonimidoyl)-1-benzothiophen-3-ol |
|---|---|
| PubChem CID | 3582254 |
| Molecular Formula | C21H15NOS |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 2-(C,N-diphenylcarbonimidoyl)-1-benzothiophen-3-ol |
| SMILES | Oc1c(/C(=N/c2ccccc2)c2ccccc2)sc2ccccc12 |
| InChI | InChI=1S/C21H15NOS/c23-20-17-13-7-8-14-18(17)24-21(20)19(15-9-3-1-4-10-15)22-16-11-5-2-6-12-16/h1-14,23H/b22-19+ |
| InChIKey | ARXIXCWMABSHJN-ZBJSNUHESA-N |
| XLogP | 5.78 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|