About copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol
copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol (PubChem CID 135967337) has the molecular formula C17H14CuN2O
and a molecular weight of 325.86 g/mol. Its IUPAC name is copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol.
Molecular Properties
| Compound Name | copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol |
| PubChem CID | 135967337 |
| Molecular Formula | C17H14CuN2O |
| Molecular Weight | 325.86 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol |
| SMILES | Oc1c(/C=N/c2ccccc2)cccc1-c1ccc[nH]1.[Cu] |
| InChI | InChI=1S/C17H14N2O.Cu/c20-17-13(12-19-14-7-2-1-3-8-14)6-4-9-15(17)16-10-5-11-18-16;/h1-12,18,20H;/b19-12+; |
| InChIKey | BROCFWAZCBCRPQ-NNTHFVATSA-N |
| XLogP | 4.14 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.86 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol?
The IUPAC name of copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol (CID 135967337) is copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol.
What is the SMILES notation for copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol?
The canonical SMILES for copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol is Oc1c(/C=N/c2ccccc2)cccc1-c1ccc[nH]1.[Cu].
What is the InChIKey of copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol?
The InChIKey is BROCFWAZCBCRPQ-NNTHFVATSA-N. The full InChI is InChI=1S/C17H14N2O.Cu/c20-17-13(12-19-14-7-2-1-3-8-14)6-4-9-15(17)16-10-5-11-18-16;/h1-12,18,20H;/b19-12+;.
What are the key properties of copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol?
copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol has a molecular weight of 325.86 g/mol, XLogP of 4.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2-(phenyliminomethyl)-6-(1H-pyrrol-2-yl)phenol is sourced from PubChem (CID 135967337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).