C40H30N10 — CID 135973971
bis(21,22,23,24-tetrahydroporphyrin-5-yl)diazene (PubChem CID 135973971) has the molecular formula C40H30N10 and a molecular weight of 650.75 g/mol. Its IUPAC name is bis(21,22,23,24-tetrahydroporphyrin-5-yl)diazene.
| Compound Name | bis(21,22,23,24-tetrahydroporphyrin-5-yl)diazene |
|---|---|
| PubChem CID | 135973971 |
| Molecular Formula | C40H30N10 |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.27 |
| IUPAC Name | bis(21,22,23,24-tetrahydroporphyrin-5-yl)diazene |
| SMILES | C1=c2ccc([nH]2)=Cc2ccc([nH]2)C(/N=N/C2=c3ccc([nH]3)=Cc3ccc([nH]3)C=c3ccc([nH]3)=Cc3ccc2[nH]3)=c2ccc([nH]2)=Cc2ccc1[nH]2 |
| InChI | InChI=1S/C40H30N10/c1-5-27-19-31-9-13-35(45-31)39(36-14-10-32(46-36)20-28-6-2-24(42-28)17-23(1)41-27)49-50-40-37-15-11-33(47-37)21-29-7-3-25(43-29)18-26-4-8-30(44-26)22-34-12-16-38(40)48-34/h1-22,41-48H/b23-17?,24-17?,25-18?,26-18?,27-19?,28-20?,29-21?,30-22?,31-19?,32-20?,33-21?,34-22?,39-35?,39-36?,40-37?,40-38?,50-49+ |
| InChIKey | MHVYEZLARYAJAH-IDJKVANGSA-N |
| XLogP | 1.38 |
| TPSA | 151.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|