C21H23N5O3S — CID 135977545
2-N-[(E)-1-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-methylthiophene-2,5-dicarboxamide (PubChem CID 135977545) has the molecular formula C21H23N5O3S and a molecular weight of 425.51 g/mol. Its IUPAC name is 2-N-[(E)-1-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-methylthiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[(E)-1-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-methylthiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 135977545 |
| Molecular Formula | C21H23N5O3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-N-[(E)-1-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-methylthiophene-2,5-dicarboxamide |
| SMILES | CNC(=O)c1ccc(C(=O)N/N=C(\C)c2c(C)[nH]n(-c3ccc(C)c(C)c3)c2=O)s1 |
| InChI | InChI=1S/C21H23N5O3S/c1-11-6-7-15(10-12(11)2)26-21(29)18(14(4)25-26)13(3)23-24-20(28)17-9-8-16(30-17)19(27)22-5/h6-10,25H,1-5H3,(H,22,27)(H,24,28)/b23-13+ |
| InChIKey | UICLYSXVVXFDKL-YDZHTSKRSA-N |
| XLogP | 2.67 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|