C20H20Cl2N6O3S — CID 135977546
N-[(E)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-(dimethylaminocarbamoyl)thiophene-2-carboxamide (PubChem CID 135977546) has the molecular formula C20H20Cl2N6O3S and a molecular weight of 495.39 g/mol. Its IUPAC name is N-[(E)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-(dimethylaminocarbamoyl)thiophene-2-carboxamide.
| Compound Name | N-[(E)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-(dimethylaminocarbamoyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 135977546 |
| Molecular Formula | C20H20Cl2N6O3S |
| Molecular Weight | 495.39 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | N-[(E)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-(dimethylaminocarbamoyl)thiophene-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccc(C(=O)NN(C)C)s1)c1c(C)[nH]n(-c2ccc(Cl)c(Cl)c2)c1=O |
| InChI | InChI=1S/C20H20Cl2N6O3S/c1-10(23-24-18(29)15-7-8-16(32-15)19(30)26-27(3)4)17-11(2)25-28(20(17)31)12-5-6-13(21)14(22)9-12/h5-9,25H,1-4H3,(H,24,29)(H,26,30)/b23-10+ |
| InChIKey | HBROUCQOJWYWGJ-AUEPDCJTSA-N |
| XLogP | 3.20 |
| TPSA | 111.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|