C23H27N5O3S — CID 173068674
2-N-[1-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-propylthiophene-2,5-dicarboxamide (PubChem CID 173068674) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is 2-N-[1-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-propylthiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[1-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-propylthiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 173068674 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 2-N-[1-[2-(3,4-dimethylphenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-propylthiophene-2,5-dicarboxamide |
| SMILES | CCCNC(=O)c1ccc(C(=O)NN=C(C)c2c(C)[nH]n(-c3ccc(C)c(C)c3)c2=O)s1 |
| InChI | InChI=1S/C23H27N5O3S/c1-6-11-24-21(29)18-9-10-19(32-18)22(30)26-25-15(4)20-16(5)27-28(23(20)31)17-8-7-13(2)14(3)12-17/h7-10,12,27H,6,11H2,1-5H3,(H,24,29)(H,26,30) |
| InChIKey | QQAOOXYCVQJSHA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|