C22H21Cl2N5O5S — CID 137146831
N-[(Z)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxamide (PubChem CID 137146831) has the molecular formula C22H21Cl2N5O5S and a molecular weight of 538.41 g/mol. Its IUPAC name is N-[(Z)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxamide.
| Compound Name | N-[(Z)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 137146831 |
| Molecular Formula | C22H21Cl2N5O5S |
| Molecular Weight | 538.41 g/mol |
| Exact Mass | 537.06 |
| IUPAC Name | N-[(Z)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-(3,4-dihydroxypyrrolidine-1-carbonyl)thiophene-2-carboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc(C(=O)N2CC(O)C(O)C2)s1)c1c(C)[nH]n(-c2ccc(Cl)c(Cl)c2)c1=O |
| InChI | InChI=1S/C22H21Cl2N5O5S/c1-10(19-11(2)27-29(22(19)34)12-3-4-13(23)14(24)7-12)25-26-20(32)17-5-6-18(35-17)21(33)28-8-15(30)16(31)9-28/h3-7,15-16,27,30-31H,8-9H2,1-2H3,(H,26,32)/b25-10- |
| InChIKey | BYHWSZSLAMOSRZ-MRUKODCESA-N |
| XLogP | 2.17 |
| TPSA | 140.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|