C24H20Cl2N6O3S — CID 135977539
2-N-[(E)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-(pyridin-4-ylmethyl)thiophene-2,5-dicarboxamide (PubChem CID 135977539) has the molecular formula C24H20Cl2N6O3S and a molecular weight of 543.44 g/mol. Its IUPAC name is 2-N-[(E)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-(pyridin-4-ylmethyl)thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-[(E)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-(pyridin-4-ylmethyl)thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 135977539 |
| Molecular Formula | C24H20Cl2N6O3S |
| Molecular Weight | 543.44 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 2-N-[(E)-1-[2-(3,4-dichlorophenyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]ethylideneamino]-5-N-(pyridin-4-ylmethyl)thiophene-2,5-dicarboxamide |
| SMILES | C/C(=N\NC(=O)c1ccc(C(=O)NCc2ccncc2)s1)c1c(C)[nH]n(-c2ccc(Cl)c(Cl)c2)c1=O |
| InChI | InChI=1S/C24H20Cl2N6O3S/c1-13(21-14(2)31-32(24(21)35)16-3-4-17(25)18(26)11-16)29-30-23(34)20-6-5-19(36-20)22(33)28-12-15-7-9-27-10-8-15/h3-11,31H,12H2,1-2H3,(H,28,33)(H,30,34)/b29-13+ |
| InChIKey | SQGBKDAMXPLSJH-VFLNYLIXSA-N |
| XLogP | 4.32 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|