C32H20F2N2O2S2Zn — CID 135981533
2-(1,3-benzothiazol-2-yl)-4-fluorophenol;2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenol;zinc (PubChem CID 135981533) has the molecular formula C32H20F2N2O2S2Zn and a molecular weight of 632.04 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4-fluorophenol;2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenol;zinc.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4-fluorophenol;2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenol;zinc |
|---|---|
| PubChem CID | 135981533 |
| Molecular Formula | C32H20F2N2O2S2Zn |
| Molecular Weight | 632.04 g/mol |
| Exact Mass | 630.02 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4-fluorophenol;2-(1,3-benzothiazol-2-yl)-4-(4-fluorophenyl)phenol;zinc |
| SMILES | Oc1ccc(-c2ccc(F)cc2)cc1-c1nc2ccccc2s1.Oc1ccc(F)cc1-c1nc2ccccc2s1.[Zn] |
| InChI | InChI=1S/C19H12FNOS.C13H8FNOS.Zn/c20-14-8-5-12(6-9-14)13-7-10-17(22)15(11-13)19-21-16-3-1-2-4-18(16)23-19;14-8-5-6-11(16)9(7-8)13-15-10-3-1-2-4-12(10)17-13;/h1-11,22H;1-7,16H; |
| InChIKey | YTPGDEXQHFAJPP-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.04 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|