C21H16F2N3O4S+ — CID 135982820
(E)-N-[4-(difluoromethoxy)phenyl]-3-hydroxy-3-(3-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide (PubChem CID 135982820) has the molecular formula C21H16F2N3O4S+ and a molecular weight of 444.44 g/mol. Its IUPAC name is (E)-N-[4-(difluoromethoxy)phenyl]-3-hydroxy-3-(3-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide.
| Compound Name | (E)-N-[4-(difluoromethoxy)phenyl]-3-hydroxy-3-(3-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
|---|---|
| PubChem CID | 135982820 |
| Molecular Formula | C21H16F2N3O4S+ |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | (E)-N-[4-(difluoromethoxy)phenyl]-3-hydroxy-3-(3-nitrophenyl)-2-pyridin-1-ium-1-ylprop-2-enethioamide |
| SMILES | O=[N+]([O-])c1cccc(/C(O)=C(/C(=S)Nc2ccc(OC(F)F)cc2)[n+]2ccccc2)c1 |
| InChI | InChI=1S/C21H15F2N3O4S/c22-21(23)30-17-9-7-15(8-10-17)24-20(31)18(25-11-2-1-3-12-25)19(27)14-5-4-6-16(13-14)26(28)29/h1-13,21H,(H-,24,27,31)/p+1 |
| InChIKey | XAXXOPVQQDZLEQ-UHFFFAOYSA-O |
| XLogP | 4.81 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|