C18H22N4O2 — CID 136519751
3-(2-methoxyphenyl)-1-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]but-2-en-1-one (PubChem CID 136519751) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 3-(2-methoxyphenyl)-1-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]but-2-en-1-one.
| Compound Name | 3-(2-methoxyphenyl)-1-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 136519751 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 3-(2-methoxyphenyl)-1-[2-(1H-1,2,4-triazol-5-yl)piperidin-1-yl]but-2-en-1-one |
| SMILES | COc1ccccc1C(C)=CC(=O)N1CCCCC1c1ncn[nH]1 |
| InChI | InChI=1S/C18H22N4O2/c1-13(14-7-3-4-9-16(14)24-2)11-17(23)22-10-6-5-8-15(22)18-19-12-20-21-18/h3-4,7,9,11-12,15H,5-6,8,10H2,1-2H3,(H,19,20,21) |
| InChIKey | KRQREYXHUDTOAM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|