C14H20N2O5S — CID 136538290
1-(2,6-dimethyl-4-nitrophenyl)sulfonyl-4,4-dimethylpyrrolidin-3-ol (PubChem CID 136538290) has the molecular formula C14H20N2O5S and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-nitrophenyl)sulfonyl-4,4-dimethylpyrrolidin-3-ol.
| Compound Name | 1-(2,6-dimethyl-4-nitrophenyl)sulfonyl-4,4-dimethylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 136538290 |
| Molecular Formula | C14H20N2O5S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-(2,6-dimethyl-4-nitrophenyl)sulfonyl-4,4-dimethylpyrrolidin-3-ol |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1S(=O)(=O)N1CC(O)C(C)(C)C1 |
| InChI | InChI=1S/C14H20N2O5S/c1-9-5-11(16(18)19)6-10(2)13(9)22(20,21)15-7-12(17)14(3,4)8-15/h5-6,12,17H,7-8H2,1-4H3 |
| InChIKey | UAOZZTUAVWKSHF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|