C17H22FN5O2 — CID 136548038
[4-(3-fluorophenyl)-2-methylpiperazin-1-yl]-[1-(2-methoxyethyl)triazol-4-yl]methanone (PubChem CID 136548038) has the molecular formula C17H22FN5O2 and a molecular weight of 347.39 g/mol. Its IUPAC name is [4-(3-fluorophenyl)-2-methylpiperazin-1-yl]-[1-(2-methoxyethyl)triazol-4-yl]methanone.
| Compound Name | [4-(3-fluorophenyl)-2-methylpiperazin-1-yl]-[1-(2-methoxyethyl)triazol-4-yl]methanone |
|---|---|
| PubChem CID | 136548038 |
| Molecular Formula | C17H22FN5O2 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | [4-(3-fluorophenyl)-2-methylpiperazin-1-yl]-[1-(2-methoxyethyl)triazol-4-yl]methanone |
| SMILES | COCCn1cc(C(=O)N2CCN(c3cccc(F)c3)CC2C)nn1 |
| InChI | InChI=1S/C17H22FN5O2/c1-13-11-21(15-5-3-4-14(18)10-15)6-7-23(13)17(24)16-12-22(20-19-16)8-9-25-2/h3-5,10,12-13H,6-9,11H2,1-2H3 |
| InChIKey | NUQZUEBDTNKHAI-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |