C15H15FN2O2S — CID 136558315
4-(4-fluorophenyl)-N-(1,2-thiazol-3-yl)oxane-4-carboxamide (PubChem CID 136558315) has the molecular formula C15H15FN2O2S and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(1,2-thiazol-3-yl)oxane-4-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-(1,2-thiazol-3-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 136558315 |
| Molecular Formula | C15H15FN2O2S |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(1,2-thiazol-3-yl)oxane-4-carboxamide |
| SMILES | O=C(Nc1ccsn1)C1(c2ccc(F)cc2)CCOCC1 |
| InChI | InChI=1S/C15H15FN2O2S/c16-12-3-1-11(2-4-12)15(6-8-20-9-7-15)14(19)17-13-5-10-21-18-13/h1-5,10H,6-9H2,(H,17,18,19) |
| InChIKey | PFDGWYFPCLTVGE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |