C16H24N6O2 — CID 136564345
2-[1-[(1-tert-butyltriazol-4-yl)methyl]pyrrolidin-2-yl]-5-methoxy-1H-pyrimidin-6-one (PubChem CID 136564345) has the molecular formula C16H24N6O2 and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-[1-[(1-tert-butyltriazol-4-yl)methyl]pyrrolidin-2-yl]-5-methoxy-1H-pyrimidin-6-one.
| Compound Name | 2-[1-[(1-tert-butyltriazol-4-yl)methyl]pyrrolidin-2-yl]-5-methoxy-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136564345 |
| Molecular Formula | C16H24N6O2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-[1-[(1-tert-butyltriazol-4-yl)methyl]pyrrolidin-2-yl]-5-methoxy-1H-pyrimidin-6-one |
| SMILES | COc1cnc(C2CCCN2Cc2cn(C(C)(C)C)nn2)[nH]c1=O |
| InChI | InChI=1S/C16H24N6O2/c1-16(2,3)22-10-11(19-20-22)9-21-7-5-6-12(21)14-17-8-13(24-4)15(23)18-14/h8,10,12H,5-7,9H2,1-4H3,(H,17,18,23) |
| InChIKey | YTZCTGKHSLMLNT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |