C17H19N5OS — CID 136567478
N-(1-methylindazol-3-yl)-2-piperidin-1-yl-1,3-thiazole-4-carboxamide (PubChem CID 136567478) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is N-(1-methylindazol-3-yl)-2-piperidin-1-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(1-methylindazol-3-yl)-2-piperidin-1-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 136567478 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | N-(1-methylindazol-3-yl)-2-piperidin-1-yl-1,3-thiazole-4-carboxamide |
| SMILES | Cn1nc(NC(=O)c2csc(N3CCCCC3)n2)c2ccccc21 |
| InChI | InChI=1S/C17H19N5OS/c1-21-14-8-4-3-7-12(14)15(20-21)19-16(23)13-11-24-17(18-13)22-9-5-2-6-10-22/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H,19,20,23) |
| InChIKey | QIDWCTVXQRDCAL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |