C15H25F3N2O5 — CID 136575822
2-ethyl-2-[(6-methylpiperidin-3-yl)carbamoyl]butanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 136575822) has the molecular formula C15H25F3N2O5 and a molecular weight of 370.37 g/mol. Its IUPAC name is 2-ethyl-2-[(6-methylpiperidin-3-yl)carbamoyl]butanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-ethyl-2-[(6-methylpiperidin-3-yl)carbamoyl]butanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 136575822 |
| Molecular Formula | C15H25F3N2O5 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 2-ethyl-2-[(6-methylpiperidin-3-yl)carbamoyl]butanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CCC(CC)(C(=O)O)C(=O)NC1CCC(C)NC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H24N2O3.C2HF3O2/c1-4-13(5-2,12(17)18)11(16)15-10-7-6-9(3)14-8-10;3-2(4,5)1(6)7/h9-10,14H,4-8H2,1-3H3,(H,15,16)(H,17,18);(H,6,7) |
| InChIKey | OUVVLGWCAAKKGL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|