C19H26F3N3O4 — CID 136576182
1-(2-cyclopropyl-2-methylpropyl)-3-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)urea;2,2,2-trifluoroacetic acid (PubChem CID 136576182) has the molecular formula C19H26F3N3O4 and a molecular weight of 417.43 g/mol. Its IUPAC name is 1-(2-cyclopropyl-2-methylpropyl)-3-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(2-cyclopropyl-2-methylpropyl)-3-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 136576182 |
| Molecular Formula | C19H26F3N3O4 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-(2-cyclopropyl-2-methylpropyl)-3-(2,3,4,5-tetrahydro-1,4-benzoxazepin-7-yl)urea;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(CNC(=O)Nc1ccc2c(c1)CNCCO2)C1CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O2.C2HF3O2/c1-17(2,13-3-4-13)11-19-16(21)20-14-5-6-15-12(9-14)10-18-7-8-22-15;3-2(4,5)1(6)7/h5-6,9,13,18H,3-4,7-8,10-11H2,1-2H3,(H2,19,20,21);(H,6,7) |
| InChIKey | NGMCXBGSQNVTOR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |