C14H18ClNO6S — CID 136581985
2-[2-chloro-4-[(3-methoxycyclobutyl)-methylsulfamoyl]phenoxy]acetic acid (PubChem CID 136581985) has the molecular formula C14H18ClNO6S and a molecular weight of 363.82 g/mol. Its IUPAC name is 2-[2-chloro-4-[(3-methoxycyclobutyl)-methylsulfamoyl]phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(3-methoxycyclobutyl)-methylsulfamoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 136581985 |
| Molecular Formula | C14H18ClNO6S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 2-[2-chloro-4-[(3-methoxycyclobutyl)-methylsulfamoyl]phenoxy]acetic acid |
| SMILES | COC1CC(N(C)S(=O)(=O)c2ccc(OCC(=O)O)c(Cl)c2)C1 |
| InChI | InChI=1S/C14H18ClNO6S/c1-16(9-5-10(6-9)21-2)23(19,20)11-3-4-13(12(15)7-11)22-8-14(17)18/h3-4,7,9-10H,5-6,8H2,1-2H3,(H,17,18) |
| InChIKey | PTUULCSRHISXRM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |