C12H14ClNO6S — CID 166249433
2-[2-chloro-4-(oxazinan-2-ylsulfonyl)phenoxy]acetic acid (PubChem CID 166249433) has the molecular formula C12H14ClNO6S and a molecular weight of 335.77 g/mol. Its IUPAC name is 2-[2-chloro-4-(oxazinan-2-ylsulfonyl)phenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-(oxazinan-2-ylsulfonyl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 166249433 |
| Molecular Formula | C12H14ClNO6S |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2-[2-chloro-4-(oxazinan-2-ylsulfonyl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(S(=O)(=O)N2CCCCO2)cc1Cl |
| InChI | InChI=1S/C12H14ClNO6S/c13-10-7-9(3-4-11(10)19-8-12(15)16)21(17,18)14-5-1-2-6-20-14/h3-4,7H,1-2,5-6,8H2,(H,15,16) |
| InChIKey | SEWPZXTVYKEFLR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |