C16H16N4O2 — CID 136585265
N-[(1R,2R)-2-hydroxycyclobutyl]-3-(1H-indol-3-yl)-1H-pyrazole-5-carboxamide (PubChem CID 136585265) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclobutyl]-3-(1H-indol-3-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclobutyl]-3-(1H-indol-3-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 136585265 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclobutyl]-3-(1H-indol-3-yl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1CC[C@H]1O)c1cc(-c2c[nH]c3ccccc23)n[nH]1 |
| InChI | InChI=1S/C16H16N4O2/c21-15-6-5-12(15)18-16(22)14-7-13(19-20-14)10-8-17-11-4-2-1-3-9(10)11/h1-4,7-8,12,15,17,21H,5-6H2,(H,18,22)(H,19,20)/t12-,15-/m1/s1 |
| InChIKey | UGSNWWFTLMZJBC-IUODEOHRSA-N |
| XLogP | 1.81 |
| TPSA | 93.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |