C18H25NO3S — CID 136587230
1-[(3aS,6aR)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-2-(4-ethylphenyl)-2-methylpropan-1-one (PubChem CID 136587230) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-[(3aS,6aR)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-2-(4-ethylphenyl)-2-methylpropan-1-one.
| Compound Name | 1-[(3aS,6aR)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-2-(4-ethylphenyl)-2-methylpropan-1-one |
|---|---|
| PubChem CID | 136587230 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-[(3aS,6aR)-2,2-dioxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-c]pyrrol-5-yl]-2-(4-ethylphenyl)-2-methylpropan-1-one |
| SMILES | CCc1ccc(C(C)(C)C(=O)N2C[C@@H]3CS(=O)(=O)C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-4-13-5-7-16(8-6-13)18(2,3)17(20)19-9-14-11-23(21,22)12-15(14)10-19/h5-8,14-15H,4,9-12H2,1-3H3/t14-,15+ |
| InChIKey | PSXVJQBHGBCCAU-GASCZTMLSA-N |
| XLogP | 2.03 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |