C14H15N3O3S — CID 136587450
[(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-([1,3]thiazolo[5,4-b]pyridin-2-yl)methanone (PubChem CID 136587450) has the molecular formula C14H15N3O3S and a molecular weight of 305.36 g/mol. Its IUPAC name is [(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-([1,3]thiazolo[5,4-b]pyridin-2-yl)methanone.
| Compound Name | [(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-([1,3]thiazolo[5,4-b]pyridin-2-yl)methanone |
|---|---|
| PubChem CID | 136587450 |
| Molecular Formula | C14H15N3O3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | [(4aS,8aS)-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]oxazin-1-yl]-([1,3]thiazolo[5,4-b]pyridin-2-yl)methanone |
| SMILES | O=C(c1nc2cccnc2s1)N1CCO[C@@H]2COCC[C@@H]21 |
| InChI | InChI=1S/C14H15N3O3S/c18-14(13-16-9-2-1-4-15-12(9)21-13)17-5-7-20-11-8-19-6-3-10(11)17/h1-2,4,10-11H,3,5-8H2/t10-,11+/m0/s1 |
| InChIKey | FGHZTKPWPZONNW-WDEREUQCSA-N |
| XLogP | 1.32 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |